EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O5 |
| Net Charge | 0 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02152 |
| SMILES | C[C@@H](C(=O)O)C(=O)C(=O)O |
| InChI | InChI=1S/C5H6O5/c1-2(4(7)8)3(6)5(9)10/h2H,1H3,(H,7,8)(H,9,10)/t2-/m1/s1 |
| InChIKey | CXJNNMFPXAHDPF-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-methyl-3-oxosuccinic acid (CHEBI:50794) is a 2-methyl-3-oxosuccinic acid (CHEBI:50793) |
| (R)-2-methyl-3-oxosuccinic acid (CHEBI:50794) is enantiomer of (S)-2-methyl-3-oxosuccinic acid (CHEBI:6885) |
| Incoming Relation(s) |
| (S)-2-methyl-3-oxosuccinic acid (CHEBI:6885) is enantiomer of (R)-2-methyl-3-oxosuccinic acid (CHEBI:50794) |
| IUPAC Name |
|---|
| (2R)-2-methyl-3-oxobutanedioic acid |