EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50789 - (3S)-3-hydroxy-L-asparagine
| Formula | C4H8N2O4 |
| Net Charge | 0 |
| Average Mass | 148.118 |
| Monoisotopic Mass | 148.04841 |
| SMILES | NC(=O)[C@@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H8N2O4/c5-1(4(9)10)2(7)3(6)8/h1-2,7H,5H2,(H2,6,8)(H,9,10)/t1-,2-/m0/s1 |
| InChIKey | VQTLPSCRBFYDNX-LWMBPPNESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-hydroxy-L-asparagine (CHEBI:50789) is a L-asparagine derivative (CHEBI:52987) |
| (3S)-3-hydroxy-L-asparagine (CHEBI:50789) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (3S)-3-hydroxy-L-asparagine (CHEBI:50789) is tautomer of (3S)-3-hydroxy-L-asparagine zwitterion (CHEBI:58850) |
| Incoming Relation(s) |
| (3S)-3-hydroxy-L-asparagine zwitterion (CHEBI:58850) is tautomer of (3S)-3-hydroxy-L-asparagine (CHEBI:50789) |
| IUPAC Names |
|---|
| (3S)-3-hydroxy-L-asparagine |
| (2S,3S)-2,4-diamino-3-hydroxy-4-oxobutanoic acid |