EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O2 |
| Net Charge | 0 |
| Average Mass | 324.464 |
| Monoisotopic Mass | 324.20893 |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(CC)CC(=C)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C22H28O2/c1-4-21-13-14(3)20-17-9-7-16(23)12-15(17)6-8-18(20)19(21)10-11-22(21,24)5-2/h2,12,17-20,24H,3-4,6-11,13H2,1H3/t17-,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | GCKFUYQCUCGESZ-BPIQYHPVSA-N |
| Roles Classification |
|---|
| Biological Role: | progestin A synthetic progestogen. |
| Applications: | female contraceptive drug A chemical substance or agent with contraceptive activity in females. contraceptive drug A chemical substance that prevents or reduces the probability of conception. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etonogestrel (CHEBI:50777) has role contraceptive drug (CHEBI:49323) |
| etonogestrel (CHEBI:50777) has role female contraceptive drug (CHEBI:49324) |
| etonogestrel (CHEBI:50777) has role progestin (CHEBI:59826) |
| etonogestrel (CHEBI:50777) is a 17β-hydroxy steroid (CHEBI:35343) |
| etonogestrel (CHEBI:50777) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| etonogestrel (CHEBI:50777) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 17α-ethynyl-17β-hydroxy-11-methylidene-18a-homo-estr-4-en-3-one |
| INNs | Source |
|---|---|
| etonogestrel | ChEBI |
| étonogestrel | IUPAC |
| etonogestrelum | ChEBI |
| Synonyms | Source |
|---|---|
| 3-Ketodesogestrel | ChemIDplus |
| 3-Oxodesogestrel | ChemIDplus |
| Brand Name | Source |
|---|---|
| Implanon | DrugBank |