EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O3 |
| Net Charge | 0 |
| Average Mass | 412.614 |
| Monoisotopic Mass | 412.29775 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@@H](O)C3CC3)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C27H40O3/c1-17(6-13-25(29)20-8-9-20)23-11-12-24-19(5-4-14-27(23,24)3)7-10-21-15-22(28)16-26(30)18(21)2/h6-7,10,13,17,20,22-26,28-30H,2,4-5,8-9,11-12,14-16H2,1,3H3/b13-6+,19-7+,21-10-/t17-,22-,23-,24+,25-,26+,27-/m1/s1 |
| InChIKey | LWQQLNNNIPYSNX-UROSTWAQSA-N |
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | antipsoriatic A drug used to treat psoriasis. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcipotriol (CHEBI:50749) has role antipsoriatic (CHEBI:50748) |
| calcipotriol (CHEBI:50749) has role drug allergen (CHEBI:88188) |
| calcipotriol (CHEBI:50749) is a cyclopropanes (CHEBI:51454) |
| calcipotriol (CHEBI:50749) is a hydroxy seco-steroid (CHEBI:36853) |
| calcipotriol (CHEBI:50749) is a seco-cholestane (CHEBI:36818) |
| calcipotriol (CHEBI:50749) is a secondary alcohol (CHEBI:35681) |
| calcipotriol (CHEBI:50749) is a triol (CHEBI:27136) |
| Incoming Relation(s) |
| calcipotriol hydrate (CHEBI:90861) has part calcipotriol (CHEBI:50749) |
| IUPAC Name |
|---|
| (1S,3R,5Z,7E,22E,24S)-26,27-cyclo-9,10-secocholesta-5,7,10,22-tetraene-1,3,24-triol |
| INN | Source |
|---|---|
| calcipotriol | DrugBank |
| Synonyms | Source |
|---|---|
| Calcipotriene | KEGG DRUG |
| Calcipotriol | KEGG DRUG |
| CALCIPOTRIOL | PDBeChem |
| MC 903 | ChEBI |
| MC-903 | ChEBI |
| MC903 | ChEBI |
| Brand Names | Source |
|---|---|
| Daivonex | ChemIDplus |
| Dovonex | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 465 | DrugCentral |
| D01125 | KEGG DRUG |
| DB02300 | DrugBank |
| HMDB0015567 | HMDB |
| LMST03020106 | LIPID MAPS |
| MC9 | PDBeChem |
| US4866048 | Patent |
| WO8700834 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5309193 | Reaxys |
| CAS:112965-21-6 | KEGG DRUG |
| CAS:112965-21-6 | ChemIDplus |
| Citations |
|---|