EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N4O6.2HCl |
| Net Charge | 0 |
| Average Mass | 517.410 |
| Monoisotopic Mass | 516.15424 |
| SMILES | Cl.Cl.O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCNCCO)ccc(NCCNCCO)c21 |
| InChI | InChI=1S/C22H28N4O6.2ClH/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32;;/h1-4,23-30H,5-12H2;2*1H |
| InChIKey | ZAHQPTJLOCWVPG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitoxantrone dihydrochloride (CHEBI:50727) has part mitoxantrone (CHEBI:50729) |
| mitoxantrone dihydrochloride (CHEBI:50727) has role antineoplastic agent (CHEBI:35610) |
| mitoxantrone dihydrochloride (CHEBI:50727) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1,4-dihydroxy-5,8-bis({2-[(2-hydroxyethyl)amino]ethyl}amino)anthracene-9,10-dione dihydrochloride |
| Synonym | Source |
|---|---|
| Mitoxantrone hydrochloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Novantron | DrugBank |
| Novantrone | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4835931 | Beilstein |
| CAS:70476-82-3 | ChemIDplus |