EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H73O6P |
| Net Charge | 0 |
| Average Mass | 717.025 |
| Monoisotopic Mass | 716.51448 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COC[C@@H](COP(=O)(O)O)OC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C43H73O6P/c1-35(2)17-11-19-37(5)21-13-23-39(7)25-15-27-41(9)29-31-47-33-43(34-49-50(44,45)46)48-32-30-42(10)28-16-26-40(8)24-14-22-38(6)20-12-18-36(3)4/h17-18,21-22,25-26,29-30,43H,11-16,19-20,23-24,27-28,31-34H2,1-10H3,(H2,44,45,46)/b37-21+,38-22+,39-25+,40-26+,41-29+,42-30+/t43-/m0/s1 |
| InChIKey | WHMXLRRVANEOOG-MVFIEKMPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-bis-O-(geranylgeranyl)-sn-glycerol 1-phosphate (CHEBI:50725) is a 2,3-bis-O-(geranylgeranyl)glycerol 1-phosphate (CHEBI:16266) |
| 2,3-bis-O-(geranylgeranyl)-sn-glycerol 1-phosphate (CHEBI:50725) is conjugate acid of 2,3-bis-O-(geranylgeranyl)-sn-glycerol 1-phosphate(2−) (CHEBI:58837) |
| Incoming Relation(s) |
| CDP-2,3-bis-O-(geranylgeranyl)-sn-glycerol (CHEBI:50726) has functional parent 2,3-bis-O-(geranylgeranyl)-sn-glycerol 1-phosphate (CHEBI:50725) |
| 2,3-bis-O-(geranylgeranyl)-sn-glycerol 1-phosphate(2−) (CHEBI:58837) is conjugate base of 2,3-bis-O-(geranylgeranyl)-sn-glycerol 1-phosphate (CHEBI:50725) |
| IUPAC Name |
|---|
| (2S)-2,3-bis{[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]oxy}propyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| 2,3-Bis-O-(geranylgeranyl)-sn-glycerol-1-phosphate | KEGG COMPOUND |
| 2,3-digeranylgeranyl sn-G-1-P | ChEBI |
| 2,3-Digeranylgeranyl sn-glycerol 1-phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04638 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6168771 | Beilstein |