EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O3 |
| Net Charge | 0 |
| Average Mass | 240.258 |
| Monoisotopic Mass | 240.07864 |
| SMILES | Oc1cc2c3c(c1)COc1cc(O)cc(c1-3)CC2 |
| InChI | InChI=1S/C15H12O3/c16-11-3-8-1-2-9-4-12(17)6-13-15(9)14(8)10(5-11)7-18-13/h3-6,16-17H,1-2,7H2 |
| InChIKey | QMOLHJKSZMURCV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flavidin (CHEBI:5072) is a phenanthrenes (CHEBI:25961) |
| Synonyms | Source |
|---|---|
| 9,10-Dihydro-5H-phenanthro[4,5-bcd]pyran-2,7-diol | KEGG COMPOUND |
| Flavidin | KEGG COMPOUND |