EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10 |
| Net Charge | 0 |
| Average Mass | 142.201 |
| Monoisotopic Mass | 142.07825 |
| SMILES | Cc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3 |
| InChIKey | QPUYECUOLPXSFR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methylnaphthalene (CHEBI:50717) has role carcinogenic agent (CHEBI:50903) |
| 1-methylnaphthalene (CHEBI:50717) has role plant metabolite (CHEBI:76924) |
| 1-methylnaphthalene (CHEBI:50717) is a methylnaphthalene (CHEBI:50715) |
| Synonyms | Source |
|---|---|
| 1-Methylnaphthalene | KEGG COMPOUND |
| alpha-Methylnaphthalene | KEGG COMPOUND |
| α-methylnaphthalene | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 1-Methylnaphthalene | Wikipedia |
| c0713 | UM-BBD |
| C14082 | KEGG COMPOUND |
| HMDB0032860 | HMDB |
| Citations |
|---|