EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19NO2S |
| Net Charge | 0 |
| Average Mass | 205.323 |
| Monoisotopic Mass | 205.11365 |
| SMILES | CSCCCCCCC(N)C(=O)O |
| InChI | InChI=1S/C9H19NO2S/c1-13-7-5-3-2-4-6-8(10)9(11)12/h8H,2-7,10H2,1H3,(H,11,12) |
| InChIKey | NBXNZQFZGOQQPE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahomomethionine (CHEBI:50712) is a methyl sulfide (CHEBI:86315) |
| tetrahomomethionine (CHEBI:50712) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| tetrahomomethionine (CHEBI:50712) is a sulfur-containing amino acid (CHEBI:26834) |
| tetrahomomethionine (CHEBI:50712) is tautomer of tetrahomomethionine zwitterion (CHEBI:58834) |
| Incoming Relation(s) |
| N-hydroxytetrahomomethionine (CHEBI:50762) has functional parent tetrahomomethionine (CHEBI:50712) |
| N,N-dihydroxytetrahomomethionine (CHEBI:50769) has functional parent tetrahomomethionine (CHEBI:50712) |
| L-tetrahomomethionine (CHEBI:137002) is a tetrahomomethionine (CHEBI:50712) |
| tetrahomomethionine zwitterion (CHEBI:58834) is tautomer of tetrahomomethionine (CHEBI:50712) |
| IUPAC Name |
|---|
| 2-amino-8-(methylsulfanyl)octanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C17225 | KEGG COMPOUND |