EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50692 - mifepristone
| Formula | C29H35NO2 |
| Net Charge | 0 |
| Average Mass | 429.604 |
| Monoisotopic Mass | 429.26678 |
| SMILES | [H][C@@]12CC[C@@](O)(C#CC)[C@@]1(C)C[C@H](c1ccc(N(C)C)cc1)C1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C29H35NO2/c1-5-15-29(32)16-14-26-24-12-8-20-17-22(31)11-13-23(20)27(24)25(18-28(26,29)2)19-6-9-21(10-7-19)30(3)4/h6-7,9-10,17,24-26,32H,8,11-14,16,18H2,1-4H3/t24-,25+,26-,28-,29-/m0/s1 |
| InChIKey | VKHAHZOOUSRJNA-GCNJZUOMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. hormone antagonist A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hormone antagonist A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. contraceptive drug A chemical substance that prevents or reduces the probability of conception. abortifacient A chemical substance that interrupts pregnancy after implantation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mifepristone (CHEBI:50692) has parent hydride estrane (CHEBI:23966) |
| mifepristone (CHEBI:50692) has role abortifacient (CHEBI:50691) |
| mifepristone (CHEBI:50692) has role anti-HIV agent (CHEBI:64946) |
| mifepristone (CHEBI:50692) has role antidepressant (CHEBI:35469) |
| mifepristone (CHEBI:50692) has role antineoplastic agent (CHEBI:35610) |
| mifepristone (CHEBI:50692) has role antipsychotic agent (CHEBI:35476) |
| mifepristone (CHEBI:50692) has role antiviral agent (CHEBI:22587) |
| mifepristone (CHEBI:50692) has role anxiolytic drug (CHEBI:35474) |
| mifepristone (CHEBI:50692) has role contraceptive drug (CHEBI:49323) |
| mifepristone (CHEBI:50692) has role hormone antagonist (CHEBI:49020) |
| mifepristone (CHEBI:50692) has role hypoglycemic agent (CHEBI:35526) |
| mifepristone (CHEBI:50692) has role synthetic oral contraceptive (CHEBI:49326) |
| mifepristone (CHEBI:50692) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| mifepristone (CHEBI:50692) is a acetylenic compound (CHEBI:73474) |
| mifepristone (CHEBI:50692) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 11β-[4-(dimethylamino)phenyl]-17β-hydroxy-17α-(prop-1-yn-1-yl)estra-4,9-dien-3-one |
| INNs | Source |
|---|---|
| mifepristona | ChemIDplus |
| mifepristone | ChemIDplus |
| mifepristonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 11-(4-DIMETHYLAMINO-PHENYL)-17-HYDROXY-13-METHYL-17-PROP-1-YNYL-1,2,6,7,8,11,12,13,14,15,16,17-DODEC AHYDRO-CYCLOPENTA[A]PHENANTHREN-3-ONE | PDBeChem |
| Mifepristone | KEGG COMPOUND |
| NSC-759862 | ChEMBL |
| RU 38486 | ChEMBL |
| RU-38486 | ChEMBL |
| RU 486 | ChEMBL |
| Brand Names | Source |
|---|---|
| Corlux | DrugBank |
| Korlym | ChEMBL |
| Mifegyne | DrugBank |
| Mifeprex | DrugBank |
| Citations |
|---|