EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C33H34FN2O5.Ca |
| Net Charge | 0 |
| Average Mass | 1155.362 |
| Monoisotopic Mass | 1154.45294 |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)[O-].CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C33H35FN2O5.Ca/c2*1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;/h2*3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);/q;;+2/p-2/t2*26-,27-;/m11./s1 |
| InChIKey | FQCKMBLVYCEXJB-MNSAWQCASA-L |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. hypoglycemic agent A drug which lowers the blood glucose level. anticholesteremic drug A substance used to lower plasma cholesterol levels. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atorvastatin calcium (CHEBI:50686) has part atorvastatin(1−) (CHEBI:50690) |
| atorvastatin calcium (CHEBI:50686) has role anti-HIV agent (CHEBI:64946) |
| atorvastatin calcium (CHEBI:50686) has role antibacterial agent (CHEBI:33282) |
| atorvastatin calcium (CHEBI:50686) has role anticholesteremic drug (CHEBI:35821) |
| atorvastatin calcium (CHEBI:50686) has role antihypertensive agent (CHEBI:35674) |
| atorvastatin calcium (CHEBI:50686) has role antineoplastic agent (CHEBI:35610) |
| atorvastatin calcium (CHEBI:50686) has role cardiovascular drug (CHEBI:35554) |
| atorvastatin calcium (CHEBI:50686) has role hypoglycemic agent (CHEBI:35526) |
| atorvastatin calcium (CHEBI:50686) has role neuroprotective agent (CHEBI:63726) |
| atorvastatin calcium (CHEBI:50686) is a organic calcium salt (CHEBI:51031) |
| Incoming Relation(s) |
| atorvastatin calcium trihydrate (CHEBI:2911) has part atorvastatin calcium (CHEBI:50686) |
| IUPAC Name |
|---|
| calcium bis{(3R,5R)-7-[3-(anilinocarbonyl)-5-(4-fluorophenyl)-2-isopropyl-4-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoate} |
| Synonyms | Source |
|---|---|
| Atorvastatin calcium (anhydrous) | ChEMBL |
| Atorvastatin calcium salt anhydrous | ChEMBL |
| Atorvastatin calcium salt trihydrate | ChEMBL |
| Calcium (betaR,deltaR)-2-(p-fluorophenyl)-beta,delta-dihydroxy-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)pyrrole-1-heptanoate (1:2) | ChemIDplus |
| NSC-758617 | ChEMBL |
| Brand Names | Source |
|---|---|
| Atorvaliq | ChEMBL |
| Atorvastan | DrugBank |
| Atorvastatin calcium component of caduet | ChEMBL |
| Atorvastatin calcium component of liptruzet | ChEMBL |
| Atorvastatin calcium component of ocustatin trihydrate | ChEMBL |
| Lipitor | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D00887 | KEGG DRUG |
| DBSALT000011 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5373842 | Reaxys |
| CAS:134523-03-8 | ChemIDplus |
| Citations |
|---|