EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2S |
| Net Charge | 0 |
| Average Mass | 114.173 |
| Monoisotopic Mass | 114.02517 |
| SMILES | Cn1ccnc1=S |
| InChI | InChI=1S/C4H6N2S/c1-6-3-2-5-4(6)7/h2-3H,1H3,(H,5,7) |
| InChIKey | PMRYVIKBURPHAH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| Application: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methimazole (CHEBI:50673) has role antithyroid drug (CHEBI:50671) |
| methimazole (CHEBI:50673) is a 1,3-dihydroimidazole-2-thiones (CHEBI:139340) |
| Incoming Relation(s) |
| methimazole S-oxide (CHEBI:63828) has functional parent methimazole (CHEBI:50673) |
| IUPAC Name |
|---|
| 1-methyl-1,3-dihydro-2H-imidazole-2-thione |
| INNs | Source |
|---|---|
| thiamazole | KEGG DRUG |
| thiamazol | ChemIDplus |
| thiamazolum | ChemIDplus |
| tiamazol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-METHYL-1,3-DIHYDRO-2H-IMIDAZOLE-2-THIONE | PDBeChem |
| 1-Methylimidazole-2(3H)-thione | ChemIDplus |
| USAF el-30 | NIST Chemistry WebBook |
| Methimazole | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Danantizol | DrugBank |
| Favistan | DrugBank |
| Strumazol | DrugBank |
| Tapazole | DrugBank |
| Thacapzol | DrugBank |
| Citations |
|---|