EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50667 - mercaptopurine
| Formula | C5H4N4S |
| Net Charge | 0 |
| Average Mass | 152.182 |
| Monoisotopic Mass | 152.01567 |
| SMILES | S=c1ncnc2ncnc12 |
| InChI | InChI=1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
| InChIKey | GLVAUDGFNGKCSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mercaptopurine (CHEBI:50667) has role anticoronaviral agent (CHEBI:149553) |
| mercaptopurine (CHEBI:50667) has role antimetabolite (CHEBI:35221) |
| mercaptopurine (CHEBI:50667) has role antineoplastic agent (CHEBI:35610) |
| mercaptopurine (CHEBI:50667) is a purines (CHEBI:26401) |
| mercaptopurine (CHEBI:50667) is tautomer of purine-6-thiol (CHEBI:2208) |
| Incoming Relation(s) |
| mercaptopurine hydrate (CHEBI:31822) has part mercaptopurine (CHEBI:50667) |
| purine-6-thiol (CHEBI:2208) is tautomer of mercaptopurine (CHEBI:50667) |
| IUPAC Name |
|---|
| 1,7-dihydro-6H-purine-6-thione |
| INNs | Source |
|---|---|
| Mercaptopurina | ChemIDplus |
| mercaptopurine | ChEBI |
| mercaptopurinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-Mercaptopurine | ChemIDplus |
| 6 MP | ChemIDplus |
| 6-MP | ChemIDplus |
| 6-Thiohypoxanthine | ChemIDplus |
| 6-Thioxopurine | ChemIDplus |
| Mercaptopurine | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Purinethol | DrugBank |
| Puri-Nethol | DrugBank |
| UniProt Name | Source |
|---|---|
| mercaptopurine | UniProt |
| Citations |
|---|