EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50663 - zanamivir
| Formula | C12H20N4O7 |
| Net Charge | 0 |
| Average Mass | 332.313 |
| Monoisotopic Mass | 332.13320 |
| SMILES | [H][C@@]1([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@H](NC(=N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C12H20N4O7/c1-4(18)15-8-5(16-12(13)14)2-7(11(21)22)23-10(8)9(20)6(19)3-17/h2,5-6,8-10,17,19-20H,3H2,1H3,(H,15,18)(H,21,22)(H4,13,14,16)/t5-,6+,8+,9+,10+/m0/s1 |
| InChIKey | ARAIBEBZBOPLMB-UFGQHTETSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zanamivir (CHEBI:50663) has role antiviral agent (CHEBI:22587) |
| zanamivir (CHEBI:50663) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| zanamivir (CHEBI:50663) is a guanidines (CHEBI:24436) |
| IUPAC Name |
|---|
| 5-acetamido-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-D-glycero-D-galacto-non-2-enonic acid |
| INN | Source |
|---|---|
| zanamivir | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (2R,3R,4S)-3-(acetylamino)-4-carbamimidamido-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid | IUPAC |
| 4-guanidino-2,4-dideoxy-2,3-dehydro-N-acetylneuraminic acid | ChemIDplus |
| 4-guanidino-Neu5Ac2en | ChemIDplus |
| 5-acetamido-2,6-anhydro-3,4,5-trideoxy-4-guanidino-D-glycero-D-galacto-non-2-enonic acid | ChemIDplus |
| 5-(acetylamino)-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-D-glycero-D-galacto-non-2-enonic acid | IUPAC |
| GANA | ChemIDplus |
| Brand Name | Source |
|---|---|
| Relenza | KEGG DRUG |