EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O7 |
| Net Charge | 0 |
| Average Mass | 332.313 |
| Monoisotopic Mass | 332.13320 |
| SMILES | [H][C@@]1([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@H](NC(=N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C12H20N4O7/c1-4(18)15-8-5(16-12(13)14)2-7(11(21)22)23-10(8)9(20)6(19)3-17/h2,5-6,8-10,17,19-20H,3H2,1H3,(H,15,18)(H,21,22)(H4,13,14,16)/t5-,6+,8+,9+,10+/m0/s1 |
| InChIKey | ARAIBEBZBOPLMB-UFGQHTETSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zanamivir (CHEBI:50663) has role antiinfective agent (CHEBI:35441) |
| zanamivir (CHEBI:50663) has role antiviral agent (CHEBI:22587) |
| zanamivir (CHEBI:50663) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| zanamivir (CHEBI:50663) has role hypoglycemic agent (CHEBI:35526) |
| zanamivir (CHEBI:50663) is a guanidines (CHEBI:24436) |
| IUPAC Name |
|---|
| 5-acetamido-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-D-glycero-D-galacto-non-2-enonic acid |
| INN | Source |
|---|---|
| zanamivir | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (2R,3R,4S)-3-(acetylamino)-4-carbamimidamido-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid | IUPAC |
| 4-guanidino-2,4-dideoxy-2,3-dehydro-N-acetylneuraminic acid | ChemIDplus |
| 4-guanidino-Neu5Ac2en | ChemIDplus |
| 5-acetamido-2,6-anhydro-3,4,5-trideoxy-4-guanidino-D-glycero-D-galacto-non-2-enonic acid | ChemIDplus |
| 5-(acetylamino)-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-D-glycero-D-galacto-non-2-enonic acid | IUPAC |
| GANA | ChemIDplus |
| Brand Name | Source |
|---|---|
| Relenza | KEGG DRUG |
| Citations |
|---|