EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H29N3O5 |
| Net Charge | 0 |
| Average Mass | 331.413 |
| Monoisotopic Mass | 331.21072 |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](O)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C15H29N3O5/c1-8(2)7-9(10(19)13(21)18-23)12(20)17-11(14(22)16-6)15(3,4)5/h8-11,19,23H,7H2,1-6H3,(H,16,22)(H,17,20)(H,18,21)/t9-,10+,11-/m1/s1 |
| InChIKey | OCSMOTCMPXTDND-OUAUKWLOSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| marimastat (CHEBI:50662) has role antineoplastic agent (CHEBI:35610) |
| marimastat (CHEBI:50662) has role matrix metalloproteinase inhibitor (CHEBI:50664) |
| marimastat (CHEBI:50662) is a hydroxamic acid (CHEBI:24650) |
| marimastat (CHEBI:50662) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2S,3R)-N4-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N1,2-dihydroxy-3-(2-methylpropyl)butanediamide |
| INN | Source |
|---|---|
| marimastat | KEGG DRUG |