EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44N2O5S |
| Net Charge | 0 |
| Average Mass | 556.769 |
| Monoisotopic Mass | 556.29709 |
| SMILES | CCCCc1oc2ccc(NS(C)(=O)=O)cc2c1C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C31H44N2O5S/c1-5-8-12-29-30(27-23-25(32-39(4,35)36)15-18-28(27)38-29)31(34)24-13-16-26(17-14-24)37-22-11-21-33(19-9-6-2)20-10-7-3/h13-18,23,32H,5-12,19-22H2,1-4H3 |
| InChIKey | ZQTNQVWKHCQYLQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dronedarone (CHEBI:50659) has role anti-arrhythmia drug (CHEBI:38070) |
| dronedarone (CHEBI:50659) has role environmental contaminant (CHEBI:78298) |
| dronedarone (CHEBI:50659) has role xenobiotic (CHEBI:35703) |
| dronedarone (CHEBI:50659) is a 1-benzofurans (CHEBI:38830) |
| dronedarone (CHEBI:50659) is a aromatic ether (CHEBI:35618) |
| dronedarone (CHEBI:50659) is a aromatic ketone (CHEBI:76224) |
| dronedarone (CHEBI:50659) is a sulfonamide (CHEBI:35358) |
| dronedarone (CHEBI:50659) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[2-butyl-3-{4-[3-(dibutylamino)propoxy]benzoyl}-1-benzofuran-5-yl]methanesulfonamide |
| INN | Source |
|---|---|
| dronedarone | KEGG DRUG |
| Synonyms | Source |
|---|---|
| N-(2-butyl-3-(4-(3-(dibutylamino)propoxy)benzoyl)-5-benzofuranyl)-methanesulfonamide | ChemIDplus |
| N-(2-butyl-3-(p-(3-(dibutylamino)propoxy)benzoyl)-5-benzofuranyl)methanesulfonamide | ChemIDplus |
| SR 33589 | ChemIDplus |
| SR 33589B | ChemIDplus |
| Brand Name | Source |
|---|---|
| Multaq | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4112 | DrugCentral |
| D02537 | KEGG DRUG |
| Dronedarone | Wikipedia |
| EP2684564 | Patent |
| MX2013006564 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8176529 | Reaxys |
| CAS:141626-36-0 | ChemIDplus |
| Citations |
|---|