EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6N2O4 |
| Net Charge | 0 |
| Average Mass | 218.168 |
| Monoisotopic Mass | 218.03276 |
| SMILES | O=[N+]([O-])c1cccc2c([N+](=O)[O-])cccc12 |
| InChI | InChI=1S/C10H6N2O4/c13-11(14)9-5-1-3-7-8(9)4-2-6-10(7)12(15)16/h1-6H |
| InChIKey | ZUTCJXFCHHDFJS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,5-dinitronaphthalene (CHEBI:50640) has role genotoxin (CHEBI:50902) |
| 1,5-dinitronaphthalene (CHEBI:50640) is a dinitronaphthalene (CHEBI:50636) |
| IUPAC Name |
|---|
| 1,5-dinitronaphthalene |
| Citations |
|---|