EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O |
| Net Charge | 0 |
| Average Mass | 88.150 |
| Monoisotopic Mass | 88.08882 |
| SMILES | CC[C@H](C)CO |
| InChI | InChI=1S/C5H12O/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | QPRQEDXDYOZYLA-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Triatoma brasiliensis (ncbitaxon:65344) | gland (BTO:0000522) | PubMed (21486009) | metasternal glands |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-methylbutan-1-ol (CHEBI:50625) is a 2-methylbutan-1-ol (CHEBI:48945) |
| (S)-2-methylbutan-1-ol (CHEBI:50625) is enantiomer of (R)-2-methylbutan-1-ol (CHEBI:50624) |
| Incoming Relation(s) |
| (R)-2-methylbutan-1-ol (CHEBI:50624) is enantiomer of (S)-2-methylbutan-1-ol (CHEBI:50625) |
| IUPAC Name |
|---|
| (2S)-2-methylbutan-1-ol |
| Synonyms | Source |
|---|---|
| (2S)-2-methyl-1-butanol | ChemIDplus |
| (S)-(−)-2-methyl-1-butanol | NIST Chemistry WebBook |
| (S)-2-methyl-1-butanol | ChemIDplus |