EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2O2 |
| Net Charge | 0 |
| Average Mass | 128.131 |
| Monoisotopic Mass | 128.05858 |
| SMILES | N#C[C@H](N)CCC(=O)O |
| InChI | InChI=1S/C5H8N2O2/c6-3-4(7)1-2-5(8)9/h4H,1-2,7H2,(H,8,9)/t4-/m1/s1 |
| InChIKey | DXWQLTOXWVWMOH-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-γ-amino-γ-cyanobutanoic acid (CHEBI:50615) is a γ-amino-γ-cyanobutanoic acid (CHEBI:28474) |
| (R)-γ-amino-γ-cyanobutanoic acid (CHEBI:50615) is enantiomer of (S)-γ-amino-γ-cyanobutanoic acid (CHEBI:50614) |
| Incoming Relation(s) |
| (S)-γ-amino-γ-cyanobutanoic acid (CHEBI:50614) is enantiomer of (R)-γ-amino-γ-cyanobutanoic acid (CHEBI:50615) |
| IUPAC Name |
|---|
| (4R)-4-amino-4-cyanobutanoic acid |