EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO4 |
| Net Charge | 0 |
| Average Mass | 209.201 |
| Monoisotopic Mass | 209.06881 |
| SMILES | [H]C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H11NO4/c12-6-11-9(10(14)15)5-7-1-3-8(13)4-2-7/h1-4,6,9,13H,5H2,(H,11,12)(H,14,15)/t9-/m0/s1 |
| InChIKey | ROUWPHMRHBMAFE-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formyl-L-tyrosine (CHEBI:50603) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| N-formyl-L-tyrosine (CHEBI:50603) is a N-acyl-L-tyrosine (CHEBI:90090) |
| N-formyl-L-tyrosine (CHEBI:50603) is a N-formyl amino acid (CHEBI:50759) |
| IUPAC Names |
|---|
| (2S)-2-(formylamino)-3-(4-hydroxyphenyl)propanoic acid |
| N-formyl-L-tyrosine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2807720 | Beilstein |