EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H48N4O16 |
| Net Charge | 0 |
| Average Mass | 864.858 |
| Monoisotopic Mass | 864.30653 |
| SMILES | C[C@@]1(CC(=O)O)/C2=C/c3nc(c(CCC(=O)O)c3CC(=O)O)Cc3nc(c(CC(=O)O)c3CCC(=O)O)/C=C3\N/C(=C\C(=N2)[C@H]1CCC(=O)O)[C@@](C)(CC(=O)O)[C@@H]3CCC(=O)O |
| InChI | InChI=1S/C42H48N4O16/c1-41(17-39(59)60)23(5-9-35(51)52)29-14-27-21(11-37(55)56)19(3-7-33(47)48)25(43-27)13-26-20(4-8-34(49)50)22(12-38(57)58)28(44-26)15-31-42(2,18-40(61)62)24(6-10-36(53)54)30(46-31)16-32(41)45-29/h14-16,23-24,43-45H,3-13,17-18H2,1-2H3,(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)(H,61,62)/b29-14-,31-15-,32-16-/t23-,24-,41+,42+/m1/s1 |
| InChIKey | OQIIYZQTTMKFAU-ZNLOQLQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| precorrin-2 (CHEBI:50602) has role Escherichia coli metabolite (CHEBI:76971) |
| precorrin-2 (CHEBI:50602) is a isobacteriochlorins (CHEBI:52582) |
| precorrin-2 (CHEBI:50602) is a precorrin (CHEBI:26228) |
| precorrin-2 (CHEBI:50602) is conjugate acid of precorrin-2(7−) (CHEBI:58827) |
| Incoming Relation(s) |
| cobalt-precorrin-2 (CHEBI:3790) has functional parent precorrin-2 (CHEBI:50602) |
| precorrin-2(7−) (CHEBI:58827) is conjugate base of precorrin-2 (CHEBI:50602) |
| IUPAC Name |
|---|
| 3,3',3'',3'''-[(7S,8S,12S,13S)-3,8,13,17-tetrakis(carboxymethyl)-8,13-dimethyl-7,8,12,13,20,24-hexahydroporphyrin-2,7,12,18-tetrayl]tetrapropanoic acid |
| Synonyms | Source |
|---|---|
| 15,23-Dihydrosirohydrochlorin | ChemIDplus |
| Dihydrosirohydrochlorin | KEGG COMPOUND |
| Precorrin 2 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:82542-92-5 | KEGG COMPOUND |
| CAS:82542-92-5 | ChemIDplus |