EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O2 |
| Net Charge | 0 |
| Average Mass | 130.187 |
| Monoisotopic Mass | 130.09938 |
| SMILES | CCC(C)COC(C)=O |
| InChI | InChI=1S/C7H14O2/c1-4-6(2)5-9-7(3)8/h6H,4-5H2,1-3H3 |
| InChIKey | XHIUFYZDQBSEMF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylbutyl acetate (CHEBI:50585) has functional parent 2-methylbutan-1-ol (CHEBI:48945) |
| 2-methylbutyl acetate (CHEBI:50585) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 2-methylbutyl acetate (CHEBI:50585) has role metabolite (CHEBI:25212) |
| 2-methylbutyl acetate (CHEBI:50585) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 2-methylbutyl acetate |
| Synonyms | Source |
|---|---|
| 2-methyl-1-butanol acetate | NIST Chemistry WebBook |
| 2-methyl-1-butyl acetate | ChemIDplus |
| 2-methylbutanol acetate | NIST Chemistry WebBook |
| acetic acid 2-methylbutyl ester | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 2-methylbutyl acetate | UniProt |