EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO4 |
| Net Charge | 0 |
| Average Mass | 317.385 |
| Monoisotopic Mass | 317.16271 |
| SMILES | Oc1ccc(CCCCNC[C@H](O)c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C18H23NO4/c20-15-7-4-13(5-8-15)3-1-2-10-19-12-18(23)14-6-9-16(21)17(22)11-14/h4-9,11,18-23H,1-3,10,12H2/t18-/m0/s1 |
| InChIKey | IIRWWTKISYTTBL-SFHVURJKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arbutamine (CHEBI:50580) has role cardiotonic drug (CHEBI:38147) |
| arbutamine (CHEBI:50580) has role β-adrenergic agonist (CHEBI:35522) |
| arbutamine (CHEBI:50580) is a catecholamine (CHEBI:33567) |
| IUPAC Name |
|---|
| 4-[(1R)-1-hydroxy-2-{[4-(4-hydroxyphenyl)butyl]amino}ethyl]benzene-1,2-diol |
| INNs | Source |
|---|---|
| arbutamina | ChemIDplus |
| arbutamine | ChemIDplus |
| arbutaminum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7937544 | Beilstein |
| CAS:128470-16-6 | ChemIDplus |