EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | CCCCCCCCCCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18(20)21/h2-16H2,1H3,(H,20,21) |
| InChIKey | YQGGUZWHNVQJMF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxooctadecanoic acid (CHEBI:50576) has functional parent octadecanoic acid (CHEBI:28842) |
| 3-oxooctadecanoic acid (CHEBI:50576) is a 3-oxo fatty acid (CHEBI:134416) |
| Incoming Relation(s) |
| 3-oxooctadecanoyl-CoA (CHEBI:50571) has functional parent 3-oxooctadecanoic acid (CHEBI:50576) |
| IUPAC Name |
|---|
| 3-oxooctadecanoic acid |
| Synonyms | Source |
|---|---|
| 3-keto stearic acid | LIPID MAPS |
| 3-ketostearic acid | ChEBI |
| 3-oxostearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0010736 | HMDB |
| LMFA02000240 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1791558 | Beilstein |