EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50567 - levosimendan
| Formula | C14H12N6O |
| Net Charge | 0 |
| Average Mass | 280.291 |
| Monoisotopic Mass | 280.10726 |
| SMILES | C[C@@H]1CC(=O)NN=C1c1ccc(NN=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C14H12N6O/c1-9-6-13(21)19-20-14(9)10-2-4-11(5-3-10)17-18-12(7-15)8-16/h2-5,9,17H,6H2,1H3,(H,19,21)/t9-/m1/s1 |
| InChIKey | WHXMKTBCFHIYNQ-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor which interferes with the action of 3',5'-cyclic-nucleotide phosphodiesterase (EC 3.1.4.17). antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. vasodilator agent A drug used to cause dilation of the blood vessels. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levosimendan (CHEBI:50567) has role anti-arrhythmia drug (CHEBI:38070) |
| levosimendan (CHEBI:50567) has role antiviral agent (CHEBI:22587) |
| levosimendan (CHEBI:50567) has role cardiotonic drug (CHEBI:38147) |
| levosimendan (CHEBI:50567) has role cardiovascular drug (CHEBI:35554) |
| levosimendan (CHEBI:50567) has role EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor (CHEBI:50568) |
| levosimendan (CHEBI:50567) has role renoprotective agent (CHEBI:231911) |
| levosimendan (CHEBI:50567) has role vasodilator agent (CHEBI:35620) |
| levosimendan (CHEBI:50567) is a hydrazone (CHEBI:38532) |
| levosimendan (CHEBI:50567) is a nitrile (CHEBI:18379) |
| levosimendan (CHEBI:50567) is a pyridazinone (CHEBI:26414) |
| IUPAC Name |
|---|
| ({4-[(4R)-4-methyl-6-oxo-1,4,5,6-tetrahydropyridazin-3-yl]phenyl}hydrazono)propanedintrile |
| INNs | Source |
|---|---|
| levosimendán | ChEBI |
| lévosimendan | ChEBI |
| levosimendanum | ChEBI |
| Synonyms | Source |
|---|---|
| NSC-759644 | ChEMBL |
| (-)-OR-1259 | ChEMBL |
| OR-1259 | ChEMBL |
| OR1259 | ChEMBL |
| Simendan, (r)- | ChEMBL |
| Brand Name | Source |
|---|---|
| Simdax | DrugBank |
| Citations |
|---|