EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N6O |
| Net Charge | 0 |
| Average Mass | 280.291 |
| Monoisotopic Mass | 280.10726 |
| SMILES | C[C@@H]1CC(=O)NN=C1c1ccc(NN=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C14H12N6O/c1-9-6-13(21)19-20-14(9)10-2-4-11(5-3-10)17-18-12(7-15)8-16/h2-5,9,17H,6H2,1H3,(H,19,21)/t9-/m1/s1 |
| InChIKey | WHXMKTBCFHIYNQ-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor which interferes with the action of 3',5'-cyclic-nucleotide phosphodiesterase (EC 3.1.4.17). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levosimendan (CHEBI:50567) has role anti-arrhythmia drug (CHEBI:38070) |
| levosimendan (CHEBI:50567) has role cardiotonic drug (CHEBI:38147) |
| levosimendan (CHEBI:50567) has role EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor (CHEBI:50568) |
| levosimendan (CHEBI:50567) has role vasodilator agent (CHEBI:35620) |
| levosimendan (CHEBI:50567) is a hydrazone (CHEBI:38532) |
| levosimendan (CHEBI:50567) is a nitrile (CHEBI:18379) |
| levosimendan (CHEBI:50567) is a pyridazinone (CHEBI:26414) |
| IUPAC Name |
|---|
| ({4-[(4R)-4-methyl-6-oxo-1,4,5,6-tetrahydropyridazin-3-yl]phenyl}hydrazono)propanedintrile |
| INNs | Source |
|---|---|
| levosimendán | ChEBI |
| lévosimendan | ChEBI |
| levosimendanum | ChEBI |
| Brand Name | Source |
|---|---|
| Simdax | DrugBank |