EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N4O9P |
| Net Charge | 0 |
| Average Mass | 457.356 |
| Monoisotopic Mass | 457.11244 |
| SMILES | Cc1cc2c(cc1C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)c1nc(=O)nc(=O)c1[N]2 |
| InChI | InChI=1S/C17H22N4O9P/c1-7-3-9-10(4-8(7)2)21(15-13(18-9)16(25)20-17(26)19-15)5-11(22)14(24)12(23)6-30-31(27,28)29/h3-4,11-12,14,22-24H,5-6H2,1-2H3,(H2,27,28,29)(H2,19,20,25,26)/t11-,12+,14-/m0/s1 |
| InChIKey | QRMADBXCFSIJKL-SCRDCRAPSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FMNH• (CHEBI:50528) is a flavin mononucleotide (CHEBI:24041) |
| FMNH• (CHEBI:50528) is conjugate acid of FMNH•(2−) (CHEBI:140311) |
| Incoming Relation(s) |
| FMNH•(2−) (CHEBI:140311) is conjugate base of FMNH• (CHEBI:50528) |
| Synonym | Source |
|---|---|
| flavin mononucleotide semiquinone radical | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4056977 | Beilstein |