EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H46N2O8 |
| Net Charge | 0 |
| Average Mass | 682.814 |
| Monoisotopic Mass | 682.32542 |
| SMILES | [H][C@]1(Cc2ccc(OC)c(OC)c2Oc2cc3c(cc2OC)-c2c(O)c(OC)cc4c2[C@]([H])(C3)N(C)CC4)c2cc(OC)c(OC)cc2CCN1C |
| InChI | InChI=1S/C40H46N2O8/c1-41-13-11-22-17-31(45-4)32(46-5)20-26(22)28(41)15-24-9-10-30(44-3)40(49-8)39(24)50-34-19-25-16-29-36-23(12-14-42(29)2)18-35(48-7)38(43)37(36)27(25)21-33(34)47-6/h9-10,17-21,28-29,43H,11-16H2,1-8H3/t28-,29-/m0/s1 |
| InChIKey | IBHSRCBKJMEBQB-VMPREFPWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fetidine (CHEBI:5049) is a bisbenzylisoquinoline alkaloid (CHEBI:133004) |
| Synonym | Source |
|---|---|
| Fetidine | KEGG COMPOUND |