EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O3 |
| Net Charge | 0 |
| Average Mass | 188.267 |
| Monoisotopic Mass | 188.14124 |
| SMILES | CC(CCC(O)C(C)C)CC(=O)O |
| InChI | InChI=1S/C10H20O3/c1-7(2)9(11)5-4-8(3)6-10(12)13/h7-9,11H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | IQBGVZDRJBTLDN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-3,7-dimethyloctanoic acid (CHEBI:50451) has functional parent octanoic acid (CHEBI:28837) |
| 6-hydroxy-3,7-dimethyloctanoic acid (CHEBI:50451) is a hydroxy fatty acid (CHEBI:24654) |
| 6-hydroxy-3,7-dimethyloctanoic acid (CHEBI:50451) is conjugate acid of 6-hydroxy-3,7-dimethyloctanoate (CHEBI:64223) |
| Incoming Relation(s) |
| (3R,6S)-6-hydroxy-3,7-dimethyloctanoic acid (CHEBI:64265) is a 6-hydroxy-3,7-dimethyloctanoic acid (CHEBI:50451) |
| (3S,6R)-6-hydroxy-3,7-dimethyloctanoic acid (CHEBI:64269) is a 6-hydroxy-3,7-dimethyloctanoic acid (CHEBI:50451) |
| 6-hydroxy-3,7-dimethyloctanoate (CHEBI:64223) is conjugate base of 6-hydroxy-3,7-dimethyloctanoic acid (CHEBI:50451) |
| IUPAC Name |
|---|
| 6-hydroxy-3,7-dimethyloctanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 6-Hydroxy-37-dimethyloctanoate | MetaCyc |
| C18067 | KEGG COMPOUND |
| LMFA01050370 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722781 | Reaxys |