EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9N |
| Net Charge | 0 |
| Average Mass | 143.189 |
| Monoisotopic Mass | 143.07350 |
| SMILES | Nc1cccc2ccccc12 |
| InChI | InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2 |
| InChIKey | RUFPHBVGCFYCNW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-naphthylamine (CHEBI:50450) has role human xenobiotic metabolite (CHEBI:76967) |
| 1-naphthylamine (CHEBI:50450) is a naphthylamine (CHEBI:50448) |
| Incoming Relation(s) |
| N-(1-naphthyl)carboxamide (CHEBI:88360) has functional parent 1-naphthylamine (CHEBI:50450) |
| N-hydroxynaphthalen-1-amine (CHEBI:34871) has functional parent 1-naphthylamine (CHEBI:50450) |
| IUPAC Name |
|---|
| naphthalen-1-amine |
| Synonyms | Source |
|---|---|
| 1-aminonaphthalene | ChemIDplus |
| 1-naftilamina | ChemIDplus |
| 1-naphthalamine | ChemIDplus |
| 1-naphthalenamine | NIST Chemistry WebBook |
| 1-Naphthylamin | ChemIDplus |
| 1-Naphthylamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1-Naphthylamine | Wikipedia |
| C14790 | KEGG COMPOUND |
| Citations |
|---|