EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O3 |
| Net Charge | 0 |
| Average Mass | 280.323 |
| Monoisotopic Mass | 280.10994 |
| SMILES | CCC(c1ccccc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C18H16O3/c1-2-13(12-8-4-3-5-9-12)16-17(19)14-10-6-7-11-15(14)21-18(16)20/h3-11,13,19H,2H2,1H3 |
| InChIKey | DQDAYGNAKTZFIW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor An EC 1.6.5.* (oxidoreductase acting on NADH or NADPH with a quinone or similar as acceptor) inhibitor that interferes with the action of NAD(P)H dehydrogenase (quinone), EC 1.6.5.2. |
| Applications: | anticoagulant An agent that prevents blood clotting. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenprocoumon (CHEBI:50438) has role anticoagulant (CHEBI:50249) |
| phenprocoumon (CHEBI:50438) has role antineoplastic agent (CHEBI:35610) |
| phenprocoumon (CHEBI:50438) has role EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor (CHEBI:50390) |
| phenprocoumon (CHEBI:50438) is a hydroxycoumarin (CHEBI:37912) |
| IUPAC Name |
|---|
| 4-hydroxy-3-(1-phenylpropyl)-2H-chromen-2-one |
| INNs | Source |
|---|---|
| fenprocumon | ChEBI |
| phenprocoumon | ChemIDplus |
| phenprocoumone | ChEBI |
| phenprocoumonum | ChEBI |
| Synonyms | Source |
|---|---|
| 3-(1-Phenylpropyl)-4-hydroxycoumarin | ChemIDplus |
| 3-(1'-Phenyl-propyl)-4-oxycoumarin | ChemIDplus |
| 3-(alpha-Ethylbenzyl)-4-hydroxycoumarin | ChemIDplus |
| 3-(alpha-Phenylpropyl)-4-hydroxycoumarin | ChemIDplus |
| 4-Hydroxy-3-(1-phenylpropyl)-2H-1-benzopyran-2-one | ChemIDplus |
| 4-hydroxy-3-(1-phenylpropyl)-2H-chromen-2-one | ChEMBL |
| Citations |
|---|