EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4 |
| Net Charge | 0 |
| Average Mass | 204.226 |
| Monoisotopic Mass | 204.11101 |
| SMILES | NCCCCN(O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C8H16N2O4/c9-5-1-2-6-10(14)7(11)3-4-8(12)13/h14H,1-6,9H2,(H,12,13) |
| InChIKey | HJMSTRBGVUJGAI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-carboxypropanoyl)-N-hydroxyputrescine (CHEBI:50430) is a N-substituted putrescine (CHEBI:26406) |
| N-(3-carboxypropanoyl)-N-hydroxyputrescine (CHEBI:50430) is a monocarboxylic acid (CHEBI:25384) |
| N-(3-carboxypropanoyl)-N-hydroxyputrescine (CHEBI:50430) is tautomer of N-(3-carboxypropanoyl)-N-hydroxyputrescine zwitterion (CHEBI:229776) |
| Incoming Relation(s) |
| N-(3-carboxypropanoyl)-N-hydroxyputrescine zwitterion (CHEBI:229776) is tautomer of N-(3-carboxypropanoyl)-N-hydroxyputrescine (CHEBI:50430) |
| IUPAC Name |
|---|
| 4-[(4-aminobutyl)(hydroxy)amino]-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| N-hydroxy-N-succinylputrescine | ChEBI |
| HSP | ChEBI |