EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O7P2 |
| Net Charge | 0 |
| Average Mass | 450.449 |
| Monoisotopic Mass | 450.19363 |
| SMILES | [H][C@@]12CCCC(C)(C)C1=CC[C@H](C)[C@@]2(C)CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C20H36O7P2/c1-15(11-14-26-29(24,25)27-28(21,22)23)10-13-20(5)16(2)8-9-17-18(20)7-6-12-19(17,3)4/h9,11,16,18H,6-8,10,12-14H2,1-5H3,(H,24,25)(H2,21,22,23)/b15-11+/t16-,18+,20+/m0/s1 |
| InChIKey | BPSHPRCHMGHBGC-AHKHSGQUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tuberculosinyl diphosphate (CHEBI:50388) has functional parent tuberculosinol (CHEBI:50387) |
| tuberculosinyl diphosphate (CHEBI:50388) is a diterpenyl phosphate (CHEBI:36772) |
| tuberculosinyl diphosphate (CHEBI:50388) is conjugate acid of tuberculosinyl diphosphate(3−) (CHEBI:58822) |
| Incoming Relation(s) |
| tuberculosinyl diphosphate(3−) (CHEBI:58822) is conjugate base of tuberculosinyl diphosphate (CHEBI:50388) |
| IUPAC Name |
|---|
| (2E)-3-methyl-5-[(1R,2S,8aS)-1,2,5,5-tetramethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]pent-2-en-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| 5(6),13-halimadiene-15-yl diphosphate | ChEBI |
| halima-5(6),13-dien-15-ol diphosphate | ChEBI |
| tuberculosinol diphosphate | ChEBI |
| Citations |
|---|