EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50373 - homatropine methylbromide
| Formula | Br.C17H24NO3 |
| Net Charge | 0 |
| Average Mass | 370.287 |
| Monoisotopic Mass | 369.09396 |
| SMILES | C[N+]1(C)C2CCC1CC(OC(=O)C(O)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C17H24NO3.BrH/c1-18(2)13-8-9-14(18)11-15(10-13)21-17(20)16(19)12-6-4-3-5-7-12;/h3-7,13-16,19H,8-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FUFVKLQESJNNAN-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homatropine methylbromide (CHEBI:50373) has role anti-ulcer drug (CHEBI:49201) |
| homatropine methylbromide (CHEBI:50373) has role antispasmodic drug (CHEBI:53784) |
| homatropine methylbromide (CHEBI:50373) has role muscarinic antagonist (CHEBI:48876) |
| homatropine methylbromide (CHEBI:50373) is a azabicycloalkane (CHEBI:38295) |
| homatropine methylbromide (CHEBI:50373) is a organic bromide salt (CHEBI:48369) |
| IUPAC Name |
|---|
| 3-[2-hydroxy(phenyl)acetoxy]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| homatropine methylbromide | WHO MedNet |
| homatropini methylbromidum | WHO MedNet |
| méthylbromure d'homatropine | WHO MedNet |
| metilbromuro de homatropina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-alpha-Hydroxy-8-methyl-1-alpha-H,5-alpha-H-tropanium bromide mandelate | ChemIDplus |
| 8-Methylhomatropinium bromide | ChemIDplus |
| Methylhomatropine bromide | ChemIDplus |
| Methylhomatropinum bromatum | ChemIDplus |
| Omatropina metilbromuro | ChemIDplus |
| Tropinium methobromide mandelate | ChemIDplus |