EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C17H24NO3 |
| Net Charge | 0 |
| Average Mass | 370.287 |
| Monoisotopic Mass | 369.09396 |
| SMILES | C[N+]1(C)C2CCC1CC(OC(=O)C(O)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C17H24NO3.BrH/c1-18(2)13-8-9-14(18)11-15(10-13)21-17(20)16(19)12-6-4-3-5-7-12;/h3-7,13-16,19H,8-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FUFVKLQESJNNAN-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homatropine methylbromide (CHEBI:50373) has role anti-ulcer drug (CHEBI:49201) |
| homatropine methylbromide (CHEBI:50373) has role antispasmodic drug (CHEBI:53784) |
| homatropine methylbromide (CHEBI:50373) has role muscarinic antagonist (CHEBI:48876) |
| homatropine methylbromide (CHEBI:50373) is a azabicycloalkane (CHEBI:38295) |
| homatropine methylbromide (CHEBI:50373) is a organic bromide salt (CHEBI:48369) |
| IUPAC Name |
|---|
| 3-[2-hydroxy(phenyl)acetoxy]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| homatropine methylbromide | WHO MedNet |
| homatropini methylbromidum | WHO MedNet |
| méthylbromure d'homatropine | WHO MedNet |
| metilbromuro de homatropina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-alpha-Hydroxy-8-methyl-1-alpha-H,5-alpha-H-tropanium bromide mandelate | ChemIDplus |
| 8-Methylhomatropinium bromide | ChemIDplus |
| Methylhomatropine bromide | ChemIDplus |
| Methylhomatropinum bromatum | ChemIDplus |
| Omatropina metilbromuro | ChemIDplus |
| Tropinium methobromide mandelate | ChemIDplus |