EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)OC(=O)C2 |
| InChI | InChI=1S/C10H16O2/c1-9(2)7-4-5-10(9,3)12-8(11)6-7/h7H,4-6H2,1-3H3/t7-,10-/m1/s1 |
| InChIKey | AXRMSBLBSHJLGO-GMSGAONNSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-1,2-campholide (CHEBI:50360) is a 1,2-campholide (CHEBI:488) |
| Incoming Relation(s) |
| (−)-5-oxo-1,2-campholide (CHEBI:18130) has functional parent (−)-1,2-campholide (CHEBI:50360) |
| IUPAC Name |
|---|
| (1R,5R)-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3824 | Beilstein |