EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C17H18N3O3S.Mg |
| Net Charge | 0 |
| Average Mass | 713.137 |
| Monoisotopic Mass | 712.19882 |
| SMILES | COc1ccc2[n-]c([S@@](=O)Cc3ncc(C)c(OC)c3C)nc2c1.COc1ccc2[n-]c([S@@](=O)Cc3ncc(C)c(OC)c3C)nc2c1.[Mg+2] |
| InChI | InChI=1S/2C17H18N3O3S.Mg/c2*1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17;/h2*5-8H,9H2,1-4H3;/q2*-1;+2/t2*24-;/m00./s1 |
| InChIKey | KWORUUGOSLYAGD-YPPDDXJESA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esomeprazole magnesium (CHEBI:50309) has part esomeprazole(1−) (CHEBI:77264) |
| esomeprazole magnesium (CHEBI:50309) has role anti-ulcer drug (CHEBI:49201) |
| esomeprazole magnesium (CHEBI:50309) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| esomeprazole magnesium (CHEBI:50309) is a magnesium salt (CHEBI:33975) |
| IUPAC Name |
|---|
| bis(5-methoxy-2-{(S)-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}benzimidazol-1-ide) magnesium |
| Synonym | Source |
|---|---|
| (−)-Omeprazole magnesium | ChemIDplus |
| Brand Names | Source |
|---|---|
| Lucen | DrugBank |
| Esopral | DrugBank |
| Axagon | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11323157 | Reaxys |
| CAS:161973-10-0 | ChemIDplus |