EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O7P2 |
| Net Charge | 0 |
| Average Mass | 450.449 |
| Monoisotopic Mass | 450.19363 |
| SMILES | [H][C@@]12CCC=C(C)[C@@]1(C)CC[C@@H](C)[C@@]2(C)CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C20H36O7P2/c1-15(11-14-26-29(24,25)27-28(21,22)23)9-12-19(4)17(3)10-13-20(5)16(2)7-6-8-18(19)20/h7,11,17-18H,6,8-10,12-14H2,1-5H3,(H,24,25)(H2,21,22,23)/b15-11+/t17-,18+,19-,20-/m1/s1 |
| InChIKey | LKJRXYMJDDAXEN-LENLPTBCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terpentedienyl diphosphate (CHEBI:50303) has parent hydride terpentetriene (CHEBI:50302) |
| terpentedienyl diphosphate (CHEBI:50303) is a diterpenyl phosphate (CHEBI:36772) |
| terpentedienyl diphosphate (CHEBI:50303) is a octahydronaphthalenes (CHEBI:138397) |
| terpentedienyl diphosphate (CHEBI:50303) is conjugate acid of terpentedienyl diphosphate(3−) (CHEBI:58821) |
| Incoming Relation(s) |
| terpentedienyl diphosphate(3−) (CHEBI:58821) is conjugate base of terpentedienyl diphosphate (CHEBI:50303) |
| IUPAC Name |
|---|
| (2E)-3-methyl-5-[(1R,2R,4aS,8aS)-1,2,4a,5-tetramethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl]pent-2-en-1-yl trihydrogen diphosphate |