EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O6 |
| Net Charge | 0 |
| Average Mass | 364.438 |
| Monoisotopic Mass | 364.18859 |
| SMILES | [H][C@@]12CCC=C(C)[C@@]1(C)C(=O)[C@H](O)[C@@H](C)[C@@]2(C)C[C@@H](O)[C@]1(C(=O)C=O)CO1 |
| InChI | InChI=1S/C20H28O6/c1-11-6-5-7-13-18(3,12(2)16(24)17(25)19(11,13)4)8-14(22)20(10-26-20)15(23)9-21/h6,9,12-14,16,22,24H,5,7-8,10H2,1-4H3/t12-,13+,14-,16-,18-,19-,20+/m1/s1 |
| InChIKey | ISTOHHFNKVUOKP-BRUMOIPRSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terpentecin (CHEBI:50301) is a carbocyclic antibiotic (CHEBI:49319) |
| terpentecin (CHEBI:50301) is a diterpenoid (CHEBI:23849) |
| terpentecin (CHEBI:50301) is a octahydronaphthalenes (CHEBI:138397) |
| terpentecin (CHEBI:50301) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| [(2S)-2-{(1R)-1-hydroxy-2-[(1S,2S,3R,4aS,8aS)-3-hydroxy-1,2,4a,5-tetramethyl-4-oxo-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl]ethyl}oxiran-2-yl](oxo)acetaldehyde |
| Registry Numbers | Sources |
|---|---|
| CAS:100440-25-3 | ChemIDplus |