EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O7P2 |
| Net Charge | 0 |
| Average Mass | 314.211 |
| Monoisotopic Mass | 314.06843 |
| SMILES | CC(C)=C[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O)C1(C)C |
| InChI | InChI=1S/C10H20O7P2/c1-7(2)5-8-9(10(8,3)4)6-16-19(14,15)17-18(11,12)13/h5,8-9H,6H2,1-4H3,(H,14,15)(H2,11,12,13)/t8-,9-/m1/s1 |
| InChIKey | AORLUAKWVIEOLL-RKDXNWHRSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R,R)-chrysanthemyl diphosphate (CHEBI:50273) is a chrysanthemyl diphosphate (CHEBI:50272) |
| (R,R)-chrysanthemyl diphosphate (CHEBI:50273) is conjugate acid of (R,R)-chrysanthemyl diphosphate(3−) (CHEBI:58819) |
| Incoming Relation(s) |
| (R,R)-chrysanthemyl diphosphate(3−) (CHEBI:58819) is conjugate base of (R,R)-chrysanthemyl diphosphate (CHEBI:50273) |
| IUPAC Name |
|---|
| [(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropyl]methyl trihydrogen diphosphate |
| Manual Xrefs | Databases |
|---|---|
| C18051 | KEGG COMPOUND |