EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14F2N3O4S.Na |
| Net Charge | 0 |
| Average Mass | 405.358 |
| Monoisotopic Mass | 405.05708 |
| SMILES | COc1ccnc(CS(=O)c2nc3cc(OC(F)F)ccc3[n-]2)c1OC.[Na+] |
| InChI | InChI=1S/C16H14F2N3O4S.Na/c1-23-13-5-6-19-12(14(13)24-2)8-26(22)16-20-10-4-3-9(25-15(17)18)7-11(10)21-16;/h3-7,15H,8H2,1-2H3;/q-1;+1 |
| InChIKey | YNWDKZIIWCEDEE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantoprazole sodium (CHEBI:50270) has part pantoprazole(1−) (CHEBI:50358) |
| pantoprazole sodium (CHEBI:50270) has role anti-ulcer drug (CHEBI:49201) |
| pantoprazole sodium (CHEBI:50270) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| pantoprazole sodium (CHEBI:50270) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 5-(difluoromethoxy)-2-{[(3,4-dimethoxypyridin-2-yl)methyl]sulfinyl}benzimidazol-1-ide |
| Brand Names | Source |
|---|---|
| Citrel | ChEBI |
| Protium | DrugBank |
| Protonix | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB00213 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5372611 | Beilstein |
| CAS:138786-67-1 | ChemIDplus |