EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | [H][C@@]1([C@@H](O)CO)O[C@@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1111h-1a_1-4]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-11H,1H2/t2-,3+,4-,5-,6+/m0/s1 |
| InChIKey | AVVWPBAENSWJCB-BYIBVSMXSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-allofuranose (CHEBI:50258) is a L-allofuranose (CHEBI:50257) |
| α-L-allofuranose (CHEBI:50258) is enantiomer of α-D-allofuranose (CHEBI:50255) |
| Incoming Relation(s) |
| α-D-allofuranose (CHEBI:50255) is enantiomer of α-L-allofuranose (CHEBI:50258) |
| IUPAC Name |
|---|
| α-L-allofuranose |
| Manual Xrefs | Databases |
|---|---|
| G43512RT | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4291663 | Beilstein |