EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | [H][C@]1([C@H](O)CO)OC(O)[C@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2222h-1x_1-4]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-11H,1H2/t2-,3+,4-,5-,6?/m1/s1 |
| InChIKey | AVVWPBAENSWJCB-CBPJZXOFSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-allofuranose (CHEBI:50254) is a allofuranose (CHEBI:50253) |
| Incoming Relation(s) |
| α-D-allofuranose (CHEBI:50255) is a D-allofuranose (CHEBI:50254) |
| β-D-allofuranose (CHEBI:50256) is a D-allofuranose (CHEBI:50254) |
| IUPAC Name |
|---|
| D-allofuranose |
| Manual Xrefs | Databases |
|---|---|
| G06107IE | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6053438 | Beilstein |