EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N4O4 |
| Net Charge | 0 |
| Average Mass | 268.273 |
| Monoisotopic Mass | 268.11715 |
| SMILES | C[C@@H](CN1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C11H16N4O4/c1-7(15-5-10(18)13-11(19)6-15)2-14-3-8(16)12-9(17)4-14/h7H,2-6H2,1H3,(H,12,16,17)(H,13,18,19)/t7-/m0/s1 |
| InChIKey | BMKDZUISNHGIBY-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-dexrazoxane (CHEBI:50223) has role antineoplastic agent (CHEBI:35610) |
| (+)-dexrazoxane (CHEBI:50223) has role cardiovascular drug (CHEBI:35554) |
| (+)-dexrazoxane (CHEBI:50223) has role chelator (CHEBI:38161) |
| (+)-dexrazoxane (CHEBI:50223) has role immunosuppressive agent (CHEBI:35705) |
| (+)-dexrazoxane (CHEBI:50223) is a razoxane (CHEBI:50225) |
| Incoming Relation(s) |
| dexrazoxane hydrochloride (CHEBI:50224) has part (+)-dexrazoxane (CHEBI:50223) |
| IUPAC Name |
|---|
| 4,4'-(2S)-propane-1,2-diyldipiperazine-2,6-dione |
| INNs | Source |
|---|---|
| dexrazoxane | ChemIDplus |
| dexrazoxano | ChemIDplus |
| dexrazoxanum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Dextrorazoxane | DrugBank |
| (+)-(S)-4,4'-Propylenedi-2,6-piperazinedione | ChemIDplus |
| (+)-1,2-Bis(3,5-dioxo-1-piperazinyl)propane | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D03730 | KEGG DRUG |
| DB00380 | DrugBank |
| Dexrazoxane | Wikipedia |
| LSM-5248 | LINCS |
| 839 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6658412 | Beilstein |
| Beilstein:8441732 | Beilstein |
| CAS:24584-09-6 | ChemIDplus |