EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N4O4 |
| Net Charge | 0 |
| Average Mass | 268.273 |
| Monoisotopic Mass | 268.11715 |
| SMILES | C[C@@H](CN1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C11H16N4O4/c1-7(15-5-10(18)13-11(19)6-15)2-14-3-8(16)12-9(17)4-14/h7H,2-6H2,1H3,(H,12,16,17)(H,13,18,19)/t7-/m0/s1 |
| InChIKey | BMKDZUISNHGIBY-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-dexrazoxane (CHEBI:50223) has role antineoplastic agent (CHEBI:35610) |
| (+)-dexrazoxane (CHEBI:50223) has role cardiovascular drug (CHEBI:35554) |
| (+)-dexrazoxane (CHEBI:50223) has role chelator (CHEBI:38161) |
| (+)-dexrazoxane (CHEBI:50223) has role immunosuppressive agent (CHEBI:35705) |
| (+)-dexrazoxane (CHEBI:50223) is a razoxane (CHEBI:50225) |
| Incoming Relation(s) |
| dexrazoxane hydrochloride (CHEBI:50224) has part (+)-dexrazoxane (CHEBI:50223) |
| IUPAC Name |
|---|
| 4,4'-(2S)-propane-1,2-diyldipiperazine-2,6-dione |
| INNs | Source |
|---|---|
| dexrazoxane | ChemIDplus |
| dexrazoxano | ChemIDplus |
| dexrazoxanum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-1,2-Bis(3,5-dioxo-1-piperazinyl)propane | ChemIDplus |
| Dextrorazoxane | DrugBank |
| (+)-(S)-4,4'-Propylenedi-2,6-piperazinedione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 839 | DrugCentral |
| D03730 | KEGG DRUG |
| DB00380 | DrugBank |
| Dexrazoxane | Wikipedia |
| LSM-5248 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6658412 | Beilstein |
| Beilstein:8441732 | Beilstein |
| CAS:24584-09-6 | ChemIDplus |