EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50209 - sophoraflavanone G
| Formula | C25H28O6 |
| Net Charge | 0 |
| Average Mass | 424.493 |
| Monoisotopic Mass | 424.18859 |
| SMILES | C=C(C)[C@H](CC=C(C)C)Cc1c(O)cc(O)c2c1O[C@H](c1ccc(O)cc1O)CC2=O |
| InChI | InChI=1S/C25H28O6/c1-13(2)5-6-15(14(3)4)9-18-20(28)11-21(29)24-22(30)12-23(31-25(18)24)17-8-7-16(26)10-19(17)27/h5,7-8,10-11,15,23,26-29H,3,6,9,12H2,1-2,4H3/t15-,23+/m1/s1 |
| InChIKey | XRYVAQQLDYTHCL-CMJOXMDJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sophora exigua (IPNI:518828-1) | - | PubMed (10839220) | |
| Sophora moorcroftiana (IPNI:518892-1) | root (BTO:0001188) | DOI (10.1248/cpb.36.2220) | |
| Sophora flavescens (ncbitaxon:49840) | root (BTO:0001188) | PubMed (10843587) | |
| Sophora leachiana (IPNI:240761-2) | root (BTO:0001188) | DOI (10.1016/0031-9422(90)85209-X) | |
| Sophora pachycarpa (ncbitaxon:149668) | root (BTO:0001188) | PubMed (17137127) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sophoraflavanone G (CHEBI:50209) has functional parent (S)-naringenin (CHEBI:17846) |
| sophoraflavanone G (CHEBI:50209) has role antimalarial (CHEBI:38068) |
| sophoraflavanone G (CHEBI:50209) has role antimicrobial agent (CHEBI:33281) |
| sophoraflavanone G (CHEBI:50209) has role antioxidant (CHEBI:22586) |
| sophoraflavanone G (CHEBI:50209) has role plant metabolite (CHEBI:76924) |
| sophoraflavanone G (CHEBI:50209) is a (2S)-flavan-4-one (CHEBI:140377) |
| sophoraflavanone G (CHEBI:50209) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sophoraflavanone G (CHEBI:50209) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| (2S)-2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2R)-5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-yl]-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2S)-5,7,2',4'-tetrahydroxy-8-lavandulylflavanone | ChEBI |
| vexibinol | ChEBI |
| UniProt Name | Source |
|---|---|
| sophoraflavanone G | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9441 | MetaCyc |
| C18053 | KEGG COMPOUND |
| LMPK12140467 | LIPID MAPS |
| Sophoraflavanone_G | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8594725 | Reaxys |
| CAS:97938-30-2 | ChemIDplus |
| Citations |
|---|