EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50209 - sophoraflavanone G
| Formula | C25H28O6 |
| Net Charge | 0 |
| Average Mass | 424.493 |
| Monoisotopic Mass | 424.18859 |
| SMILES | C=C(C)[C@H](CC=C(C)C)Cc1c(O)cc(O)c2c1O[C@H](c1ccc(O)cc1O)CC2=O |
| InChI | InChI=1S/C25H28O6/c1-13(2)5-6-15(14(3)4)9-18-20(28)11-21(29)24-22(30)12-23(31-25(18)24)17-8-7-16(26)10-19(17)27/h5,7-8,10-11,15,23,26-29H,3,6,9,12H2,1-2,4H3/t15-,23+/m1/s1 |
| InChIKey | XRYVAQQLDYTHCL-CMJOXMDJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sophora exigua (IPNI:518828-1) | - | PubMed (10839220) | |
| Sophora flavescens (ncbitaxon:49840) | root (BTO:0001188) | PubMed (10843587) | |
| Sophora leachiana (IPNI:240761-2) | root (BTO:0001188) | DOI (10.1016/0031-9422(90)85209-X) | |
| Sophora moorcroftiana (IPNI:518892-1) | root (BTO:0001188) | DOI (10.1248/cpb.36.2220) | |
| Sophora pachycarpa (ncbitaxon:149668) | root (BTO:0001188) | PubMed (17137127) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sophoraflavanone G (CHEBI:50209) has functional parent (S)-naringenin (CHEBI:17846) |
| sophoraflavanone G (CHEBI:50209) has role antimalarial (CHEBI:38068) |
| sophoraflavanone G (CHEBI:50209) has role antimicrobial agent (CHEBI:33281) |
| sophoraflavanone G (CHEBI:50209) has role antioxidant (CHEBI:22586) |
| sophoraflavanone G (CHEBI:50209) has role plant metabolite (CHEBI:76924) |
| sophoraflavanone G (CHEBI:50209) is a (2S)-flavan-4-one (CHEBI:140377) |
| sophoraflavanone G (CHEBI:50209) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sophoraflavanone G (CHEBI:50209) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| (2S)-2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2R)-5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-yl]-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2S)-5,7,2',4'-tetrahydroxy-8-lavandulylflavanone | ChEBI |
| vexibinol | ChEBI |
| UniProt Name | Source |
|---|---|
| sophoraflavanone G | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C18053 | KEGG COMPOUND |
| CPD-9441 | MetaCyc |
| LMPK12140467 | LIPID MAPS |
| Sophoraflavanone_G | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8594725 | Reaxys |
| CAS:97938-30-2 | ChemIDplus |
| Citations |
|---|