EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c1O[C@H](c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C20H20O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9,18,21-23H,8,10H2,1-2H3/t18-/m0/s1 |
| InChIKey | LPEPZZAVFJPLNZ-SFHVURJKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga bicolor (ncbitaxon:396452) | - | PubMed (21275386) | Methanol-Dichloromethane (1:1) extract of dried, ground plant material |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sophoraflavanone B (CHEBI:50207) has functional parent (S)-naringenin (CHEBI:17846) |
| sophoraflavanone B (CHEBI:50207) has role plant metabolite (CHEBI:76924) |
| sophoraflavanone B (CHEBI:50207) has role platelet aggregation inhibitor (CHEBI:50427) |
| sophoraflavanone B (CHEBI:50207) is a (2S)-flavan-4-one (CHEBI:140377) |
| sophoraflavanone B (CHEBI:50207) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sophoraflavanone B (CHEBI:50207) is a trihydroxyflavanone (CHEBI:38739) |
| sophoraflavanone B (CHEBI:50207) is conjugate acid of sophoraflavanone B(1−) (CHEBI:58812) |
| Incoming Relation(s) |
| sophoraflavanone B(1−) (CHEBI:58812) is conjugate base of sophoraflavanone B (CHEBI:50207) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (−)-(2S)-8-dimethylallylnaringenin | IUBMB |
| (−)-(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)chroman-4-one | IUBMB |
| (S)-8-dimethylallylnaringenin | ChEBI |
| 8-prenylnaringenin | ChEBI |
| 8-Prenylnaringenin | KEGG COMPOUND |
| Flavaprenin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| sophoraflavanone B | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140279 | LIPID MAPS |
| CPD-9440 | MetaCyc |
| Sophoraflavanone_B | Wikipedia |
| C18023 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5611472 | Reaxys |
| Citations |
|---|