EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20FN3O3 |
| Net Charge | 0 |
| Average Mass | 333.363 |
| Monoisotopic Mass | 333.14887 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C17H20FN3O3/c1-3-20-10-12(17(23)24)16(22)11-8-13(18)15(9-14(11)20)21-6-4-19(2)5-7-21/h8-10H,3-7H2,1-2H3,(H,23,24) |
| InChIKey | FHFYDNQZQSQIAI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pefloxacin (CHEBI:50199) has role antibacterial drug (CHEBI:36047) |
| pefloxacin (CHEBI:50199) has role antiinfective agent (CHEBI:35441) |
| pefloxacin (CHEBI:50199) has role DNA synthesis inhibitor (CHEBI:59517) |
| pefloxacin (CHEBI:50199) is a N-alkylpiperazine (CHEBI:46845) |
| pefloxacin (CHEBI:50199) is a N-arylpiperazine (CHEBI:46848) |
| pefloxacin (CHEBI:50199) is a fluoroquinolone antibiotic (CHEBI:87211) |
| pefloxacin (CHEBI:50199) is a monocarboxylic acid (CHEBI:25384) |
| pefloxacin (CHEBI:50199) is a quinolone (CHEBI:23765) |
| pefloxacin (CHEBI:50199) is a quinolone antibiotic (CHEBI:86324) |
| Incoming Relation(s) |
| pefloxacin mesylate (CHEBI:50194) has part pefloxacin (CHEBI:50199) |
| IUPAC Name |
|---|
| 1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| pefloxacin | ChemIDplus |
| pefloxacino | ChemIDplus |
| pefloxacinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Pefloxacine | ChemIDplus |
| PFLX | DrugBank |
| perfloxacin | ChEBI |
| Brand Name | Source |
|---|---|
| Labocton | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB00487 | DrugBank |
| D02306 | KEGG DRUG |
| DE2840910 | Patent |
| US4292317 | Patent |
| Pefloxacin | Wikipedia |
| HMDB0014630 | HMDB |
| LSM-5653 | LINCS |
| US5095112 | Patent |
| 2071 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:567618 | Reaxys |
| CAS:70458-92-3 | ChemIDplus |
| Citations |
|---|