EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42FeN9O12 |
| Net Charge | 0 |
| Average Mass | 740.529 |
| Monoisotopic Mass | 740.23023 |
| SMILES | [H][C@]12CCCN3[O][Fe-3]456([O]N(CCC[C@]([H])(NC(=O)[C@]([H])(CCCN([O]4)C(C)=[O+]5)NC1=O)C(=O)NCC(=O)NCC(=O)NCC(=O)N2)C(C)=[O+]6)[O+]=C3C |
| InChI | InChI=1S/C27H42N9O12.Fe/c1-16(37)34(46)10-4-7-19-25(43)30-14-23(41)28-13-22(40)29-15-24(42)31-20(8-5-11-35(47)17(2)38)26(44)33-21(27(45)32-19)9-6-12-36(48)18(3)39;/h19-21H,4-15H2,1-3H3,(H,28,41)(H,29,40)(H,30,43)(H,31,42)(H,32,45)(H,33,44);/q-3;+3/t19-,20-,21-;/m0./s1 |
| InChIKey | GGUNGDGGXMHBMJ-OCIDDWSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferrichrome (CHEBI:5019) has role Escherichia coli metabolite (CHEBI:76971) |
| ferrichrome (CHEBI:5019) is a ferrichromes (CHEBI:61414) |
| IUPAC Name |
|---|
| (cyclo{glycyl-N5-(hydroxy-κO)-N5-[1-(oxo-κO)ethyl]-L-ornithyl-N5-(hydroxy-κO)-N5-[1-(oxo-κO)ethyl]-L-ornithyl-N5-(hydroxy-κO)-N5-[1-(oxo-κO)ethyl]-L-ornithylglycylglycyl})iron |
| Synonym | Source |
|---|---|
| Ferrichrome | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| ferrichrome | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14617047 | Reaxys |
| CAS:15630-64-5 | ChemIDplus |
| Citations |
|---|