EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50182 - 3,3'-diindolylmethane
| Formula | C17H14N2 |
| Net Charge | 0 |
| Average Mass | 246.313 |
| Monoisotopic Mass | 246.11570 |
| SMILES | c1ccc2c(Cc3cnc4ccccc34)cnc2c1 |
| InChI | InChI=1S/C17H14N2/c1-3-7-16-14(5-1)12(10-18-16)9-13-11-19-17-8-4-2-6-15(13)17/h1-8,10-11,18-19H,9H2 |
| InChIKey | VFTRKSBEFQDZKX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3'-diindolylmethane (CHEBI:50182) has role antineoplastic agent (CHEBI:35610) |
| 3,3'-diindolylmethane (CHEBI:50182) has role P450 inhibitor (CHEBI:50183) |
| 3,3'-diindolylmethane (CHEBI:50182) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| 3,3'-methylenebis(1H-indole) |
| Synonyms | Source |
|---|---|
| 3,3'-methylenebis-1H-indole | ChemIDplus |
| bis-1H-indol-3-ylmethane | ChEBI |
| DIM | ChEBI |
| Citations |
|---|