EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COc1ccc(C2COc3cc(O)cc(O)c3C2=O)c(O)c1 |
| InChI | InChI=1S/C16H14O6/c1-21-9-2-3-10(12(18)6-9)11-7-22-14-5-8(17)4-13(19)15(14)16(11)20/h2-6,11,17-19H,7H2,1H3 |
| InChIKey | CBEPNYOFLRIAGR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cajanus cajan (ncbitaxon:3821) | - | PubMed (136119) | |
| Gynerium sagittatum (ncbitaxon:42053) | - | PubMed (17442349) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferreirin (CHEBI:5018) has functional parent isoflavanone (CHEBI:27945) |
| ferreirin (CHEBI:5018) has role plant metabolite (CHEBI:76924) |
| ferreirin (CHEBI:5018) is a hydroxyisoflavanone (CHEBI:72739) |
| ferreirin (CHEBI:5018) is a methoxyisoflavanone (CHEBI:72740) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(2-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 2,3-Dihydro-5,7-dihydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002524 | KNApSAcK |
| C10419 | KEGG COMPOUND |
| HMDB0031657 | HMDB |
| LMPK12050501 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:324262 | Reaxys |
| CAS:32898-79-6 | KEGG COMPOUND |
| Citations |
|---|