EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O2 |
| Net Charge | 0 |
| Average Mass | 318.501 |
| Monoisotopic Mass | 318.25588 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])C(C)=O)[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15+,16-,17+,18-,19-,20-,21+/m0/s1 |
| InChIKey | AURFZBICLPNKBZ-SYBPFIFISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brexanolone (CHEBI:50169) has role antidepressant (CHEBI:35469) |
| brexanolone (CHEBI:50169) has role GABA modulator (CHEBI:50268) |
| brexanolone (CHEBI:50169) has role human metabolite (CHEBI:77746) |
| brexanolone (CHEBI:50169) has role intravenous anaesthetic (CHEBI:38877) |
| brexanolone (CHEBI:50169) has role sedative (CHEBI:35717) |
| brexanolone (CHEBI:50169) is a 3-hydroxy-5α-pregnan-20-one (CHEBI:50170) |
| IUPAC Name |
|---|
| 3α-hydroxy-5α-pregnan-20-one |
| INNs | Source |
|---|---|
| brexanolona | WHO MedNet |
| brexanolone | WHO MedNet |
| brexanolone | WHO MedNet |
| brexanolonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (3α,5α)-3-hydroxypregnan-20-one | NIST Chemistry WebBook |
| 3α,5α-tetrahydroprogesterone | ChemIDplus |
| 3α,5α-THP | ChemIDplus |
| 3α-hydroxy-5α-dihydroprogesterone | ChemIDplus |
| 3α-OH DHP | KEGG COMPOUND |
| 5α-pregnan-3α-ol-20-one | HMDB |
| Brand Name | Source |
|---|---|
| Zulresso | ChEBI |
| UniProt Name | Source |
|---|---|
| 3α-hydroxy-5α-pregnan-20-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Allopregnanolone | Wikipedia |
| C13712 | KEGG COMPOUND |
| D11149 | KEGG DRUG |
| DB11859 | DrugBank |
| FDB022630 | FooDB |
| HMDB0001449 | HMDB |
| LMST02030130 | LIPID MAPS |
| LSM-19998 | LINCS |
| Citations |
|---|