EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H13N5O2 |
| Net Charge | 0 |
| Average Mass | 163.181 |
| Monoisotopic Mass | 163.10692 |
| SMILES | NCCN(CCN)N(O)N=O |
| InChI | InChI=1S/C4H13N5O2/c5-1-3-8(4-2-6)9(11)7-10/h11H,1-6H2 |
| InChIKey | HMRRJTFDJAVRMR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1-bis(2-aminoethyl)-2-hydroxy-3-oxotriazane (CHEBI:50154) has parent hydride triazane (CHEBI:50155) |
| 1,1-bis(2-aminoethyl)-2-hydroxy-3-oxotriazane (CHEBI:50154) has role nitric oxide donor (CHEBI:50566) |
| 1,1-bis(2-aminoethyl)-2-hydroxy-3-oxotriazane (CHEBI:50154) is a nitroso compound (CHEBI:35800) |
| 1,1-bis(2-aminoethyl)-2-hydroxy-3-oxotriazane (CHEBI:50154) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1,1-bis(2-aminoethyl)-2-hydroxy-3-oxotriazane |
| Synonyms | Source |
|---|---|
| 2,2'-(hydroxynitrosohydrazino)bis-ethanamine | ChemIDplus |
| DETA NONOate | ChemIDplus |
| NOC-18 | ChemIDplus |
| diethylenetriamine NONOate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8139626 | Reaxys |
| CAS:146724-94-9 | ChemIDplus |
| Citations |
|---|